C16H8Br2INO2 — CID 19670964
(4Z)-2-(3-bromo-4-iodophenyl)-4-[(4-bromophenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 19670964) has the molecular formula C16H8Br2INO2 and a molecular weight of 532.96 g/mol. Its IUPAC name is (4Z)-2-(3-bromo-4-iodophenyl)-4-[(4-bromophenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(3-bromo-4-iodophenyl)-4-[(4-bromophenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19670964 |
| Molecular Formula | C16H8Br2INO2 |
| Molecular Weight | 532.96 g/mol |
| Exact Mass | 530.80 |
| IUPAC Name | (4Z)-2-(3-bromo-4-iodophenyl)-4-[(4-bromophenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccc(I)c(Br)c2)=N/C1=C\c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H8Br2INO2/c17-11-4-1-9(2-5-11)7-14-16(21)22-15(20-14)10-3-6-13(19)12(18)8-10/h1-8H/b14-7- |
| InChIKey | DLIMSUJCBQQGQC-AUWJEWJLSA-N |
| XLogP | 5.16 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.96 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|