C26H21ClN2O6 — CID 19672182
(4Z)-2-(2-chloro-5-nitrophenyl)-4-[[3-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-1,3-oxazol-5-one (PubChem CID 19672182) has the molecular formula C26H21ClN2O6 and a molecular weight of 492.92 g/mol. Its IUPAC name is (4Z)-2-(2-chloro-5-nitrophenyl)-4-[[3-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(2-chloro-5-nitrophenyl)-4-[[3-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19672182 |
| Molecular Formula | C26H21ClN2O6 |
| Molecular Weight | 492.92 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | (4Z)-2-(2-chloro-5-nitrophenyl)-4-[[3-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-1,3-oxazol-5-one |
| SMILES | CCOc1cc(/C=C2\N=C(c3cc([N+](=O)[O-])ccc3Cl)OC2=O)ccc1OCc1cccc(C)c1 |
| InChI | InChI=1S/C26H21ClN2O6/c1-3-33-24-13-17(7-10-23(24)34-15-18-6-4-5-16(2)11-18)12-22-26(30)35-25(28-22)20-14-19(29(31)32)8-9-21(20)27/h4-14H,3,15H2,1-2H3/b22-12- |
| InChIKey | WGDYRQGEAYESSW-UUYOSTAYSA-N |
| XLogP | 5.88 |
| TPSA | 100.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.92 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|