C25H19Cl2NO4 — CID 19672698
(4Z)-2-(3,4-dichlorophenyl)-4-[[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-1,3-oxazol-5-one (PubChem CID 19672698) has the molecular formula C25H19Cl2NO4 and a molecular weight of 468.34 g/mol. Its IUPAC name is (4Z)-2-(3,4-dichlorophenyl)-4-[[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(3,4-dichlorophenyl)-4-[[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19672698 |
| Molecular Formula | C25H19Cl2NO4 |
| Molecular Weight | 468.34 g/mol |
| Exact Mass | 467.07 |
| IUPAC Name | (4Z)-2-(3,4-dichlorophenyl)-4-[[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-1,3-oxazol-5-one |
| SMILES | COc1cc(/C=C2\N=C(c3ccc(Cl)c(Cl)c3)OC2=O)ccc1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C25H19Cl2NO4/c1-15-3-5-16(6-4-15)14-31-22-10-7-17(12-23(22)30-2)11-21-25(29)32-24(28-21)18-8-9-19(26)20(27)13-18/h3-13H,14H2,1-2H3/b21-11- |
| InChIKey | HXYCEENFNHNYBZ-NHDPSOOVSA-N |
| XLogP | 6.23 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.34 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|