C29H23NO4 — CID 19674958
(4Z)-4-[[3-methoxy-2-[(3-methylphenyl)methoxy]phenyl]methylidene]-2-naphthalen-2-yl-1,3-oxazol-5-one (PubChem CID 19674958) has the molecular formula C29H23NO4 and a molecular weight of 449.51 g/mol. Its IUPAC name is (4Z)-4-[[3-methoxy-2-[(3-methylphenyl)methoxy]phenyl]methylidene]-2-naphthalen-2-yl-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[[3-methoxy-2-[(3-methylphenyl)methoxy]phenyl]methylidene]-2-naphthalen-2-yl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19674958 |
| Molecular Formula | C29H23NO4 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | (4Z)-4-[[3-methoxy-2-[(3-methylphenyl)methoxy]phenyl]methylidene]-2-naphthalen-2-yl-1,3-oxazol-5-one |
| SMILES | COc1cccc(/C=C2\N=C(c3ccc4ccccc4c3)OC2=O)c1OCc1cccc(C)c1 |
| InChI | InChI=1S/C29H23NO4/c1-19-7-5-8-20(15-19)18-33-27-23(11-6-12-26(27)32-2)17-25-29(31)34-28(30-25)24-14-13-21-9-3-4-10-22(21)16-24/h3-17H,18H2,1-2H3/b25-17- |
| InChIKey | UURNQEHZCDCSBP-UQQQWYQISA-N |
| XLogP | 6.08 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|