About 1-cyclohexyl-3-[1-(2,4-dimethylphenyl)ethyl]thiourea
1-cyclohexyl-3-[1-(2,4-dimethylphenyl)ethyl]thiourea (PubChem CID 19675254) has the molecular formula C17H26N2S
and a molecular weight of 290.48 g/mol. Its IUPAC name is 1-cyclohexyl-3-[1-(2,4-dimethylphenyl)ethyl]thiourea.
Molecular Properties
| Compound Name | 1-cyclohexyl-3-[1-(2,4-dimethylphenyl)ethyl]thiourea |
| PubChem CID | 19675254 |
| Molecular Formula | C17H26N2S |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 1-cyclohexyl-3-[1-(2,4-dimethylphenyl)ethyl]thiourea |
| SMILES | Cc1ccc(C(C)NC(=S)NC2CCCCC2)c(C)c1 |
| InChI | InChI=1S/C17H26N2S/c1-12-9-10-16(13(2)11-12)14(3)18-17(20)19-15-7-5-4-6-8-15/h9-11,14-15H,4-8H2,1-3H3,(H2,18,19,20) |
| InChIKey | UHXYJVWYBBHGJW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-3-[1-(2,4-dimethylphenyl)ethyl]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-3-[1-(2,4-dimethylphenyl)ethyl]thiourea?
The IUPAC name of 1-cyclohexyl-3-[1-(2,4-dimethylphenyl)ethyl]thiourea (CID 19675254) is 1-cyclohexyl-3-[1-(2,4-dimethylphenyl)ethyl]thiourea.
What is the SMILES notation for 1-cyclohexyl-3-[1-(2,4-dimethylphenyl)ethyl]thiourea?
The canonical SMILES for 1-cyclohexyl-3-[1-(2,4-dimethylphenyl)ethyl]thiourea is Cc1ccc(C(C)NC(=S)NC2CCCCC2)c(C)c1.
What is the InChIKey of 1-cyclohexyl-3-[1-(2,4-dimethylphenyl)ethyl]thiourea?
The InChIKey is UHXYJVWYBBHGJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2S/c1-12-9-10-16(13(2)11-12)14(3)18-17(20)19-15-7-5-4-6-8-15/h9-11,14-15H,4-8H2,1-3H3,(H2,18,19,20).
What are the key properties of 1-cyclohexyl-3-[1-(2,4-dimethylphenyl)ethyl]thiourea?
1-cyclohexyl-3-[1-(2,4-dimethylphenyl)ethyl]thiourea has a molecular weight of 290.48 g/mol, XLogP of 4.16, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-3-[1-(2,4-dimethylphenyl)ethyl]thiourea is sourced from PubChem (CID 19675254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).