C18H22N2S — CID 19675375
1-(2-methylphenyl)-3-[1-(4-methylphenyl)propyl]thiourea (PubChem CID 19675375) has the molecular formula C18H22N2S and a molecular weight of 298.46 g/mol. Its IUPAC name is 1-(2-methylphenyl)-3-[1-(4-methylphenyl)propyl]thiourea.
| Compound Name | 1-(2-methylphenyl)-3-[1-(4-methylphenyl)propyl]thiourea |
|---|---|
| PubChem CID | 19675375 |
| Molecular Formula | C18H22N2S |
| Molecular Weight | 298.46 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 1-(2-methylphenyl)-3-[1-(4-methylphenyl)propyl]thiourea |
| SMILES | CCC(NC(=S)Nc1ccccc1C)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H22N2S/c1-4-16(15-11-9-13(2)10-12-15)19-18(21)20-17-8-6-5-7-14(17)3/h5-12,16H,4H2,1-3H3,(H2,19,20,21) |
| InChIKey | YYPYSGPGZXLALK-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|