C15H17N3OS2 — CID 19676436
1-(3-methoxyphenyl)-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)thiourea (PubChem CID 19676436) has the molecular formula C15H17N3OS2 and a molecular weight of 319.45 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)thiourea.
| Compound Name | 1-(3-methoxyphenyl)-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)thiourea |
|---|---|
| PubChem CID | 19676436 |
| Molecular Formula | C15H17N3OS2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 1-(3-methoxyphenyl)-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)thiourea |
| SMILES | COc1cccc(NC(=S)Nc2nc3c(s2)CCCC3)c1 |
| InChI | InChI=1S/C15H17N3OS2/c1-19-11-6-4-5-10(9-11)16-14(20)18-15-17-12-7-2-3-8-13(12)21-15/h4-6,9H,2-3,7-8H2,1H3,(H2,16,17,18,20) |
| InChIKey | JIIYIVHJGZHVAB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|