About 1-(2-bromo-4,6-difluorophenyl)-3-(2-chlorophenyl)thiourea
1-(2-bromo-4,6-difluorophenyl)-3-(2-chlorophenyl)thiourea (PubChem CID 19679700) has the molecular formula C13H8BrClF2N2S
and a molecular weight of 377.64 g/mol. Its IUPAC name is 1-(2-bromo-4,6-difluorophenyl)-3-(2-chlorophenyl)thiourea.
Molecular Properties
| Compound Name | 1-(2-bromo-4,6-difluorophenyl)-3-(2-chlorophenyl)thiourea |
| PubChem CID | 19679700 |
| Molecular Formula | C13H8BrClF2N2S |
| Molecular Weight | 377.64 g/mol |
| Exact Mass | 375.92 |
| IUPAC Name | 1-(2-bromo-4,6-difluorophenyl)-3-(2-chlorophenyl)thiourea |
| SMILES | Fc1cc(F)c(NC(=S)Nc2ccccc2Cl)c(Br)c1 |
| InChI | InChI=1S/C13H8BrClF2N2S/c14-8-5-7(16)6-10(17)12(8)19-13(20)18-11-4-2-1-3-9(11)15/h1-6H,(H2,18,19,20) |
| InChIKey | QYEASUQULNAIBR-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.64 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-bromo-4,6-difluorophenyl)-3-(2-chlorophenyl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-bromo-4,6-difluorophenyl)-3-(2-chlorophenyl)thiourea?
The IUPAC name of 1-(2-bromo-4,6-difluorophenyl)-3-(2-chlorophenyl)thiourea (CID 19679700) is 1-(2-bromo-4,6-difluorophenyl)-3-(2-chlorophenyl)thiourea.
What is the SMILES notation for 1-(2-bromo-4,6-difluorophenyl)-3-(2-chlorophenyl)thiourea?
The canonical SMILES for 1-(2-bromo-4,6-difluorophenyl)-3-(2-chlorophenyl)thiourea is Fc1cc(F)c(NC(=S)Nc2ccccc2Cl)c(Br)c1.
What is the InChIKey of 1-(2-bromo-4,6-difluorophenyl)-3-(2-chlorophenyl)thiourea?
The InChIKey is QYEASUQULNAIBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8BrClF2N2S/c14-8-5-7(16)6-10(17)12(8)19-13(20)18-11-4-2-1-3-9(11)15/h1-6H,(H2,18,19,20).
What are the key properties of 1-(2-bromo-4,6-difluorophenyl)-3-(2-chlorophenyl)thiourea?
1-(2-bromo-4,6-difluorophenyl)-3-(2-chlorophenyl)thiourea has a molecular weight of 377.64 g/mol, XLogP of 5.19, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-bromo-4,6-difluorophenyl)-3-(2-chlorophenyl)thiourea is sourced from PubChem (CID 19679700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).