About N-(2,4,4-trimethylpentan-2-yl)methanesulfonamide
N-(2,4,4-trimethylpentan-2-yl)methanesulfonamide (PubChem CID 19681856) has the molecular formula C9H21NO2S
and a molecular weight of 207.34 g/mol. Its IUPAC name is N-(2,4,4-trimethylpentan-2-yl)methanesulfonamide.
Molecular Properties
| Compound Name | N-(2,4,4-trimethylpentan-2-yl)methanesulfonamide |
| PubChem CID | 19681856 |
| Molecular Formula | C9H21NO2S |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | N-(2,4,4-trimethylpentan-2-yl)methanesulfonamide |
| SMILES | CC(C)(C)CC(C)(C)NS(C)(=O)=O |
| InChI | InChI=1S/C9H21NO2S/c1-8(2,3)7-9(4,5)10-13(6,11)12/h10H,7H2,1-6H3 |
| InChIKey | YDGWZTQORFEMST-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2,4,4-trimethylpentan-2-yl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,4,4-trimethylpentan-2-yl)methanesulfonamide?
The IUPAC name of N-(2,4,4-trimethylpentan-2-yl)methanesulfonamide (CID 19681856) is N-(2,4,4-trimethylpentan-2-yl)methanesulfonamide.
What is the SMILES notation for N-(2,4,4-trimethylpentan-2-yl)methanesulfonamide?
The canonical SMILES for N-(2,4,4-trimethylpentan-2-yl)methanesulfonamide is CC(C)(C)CC(C)(C)NS(C)(=O)=O.
What is the InChIKey of N-(2,4,4-trimethylpentan-2-yl)methanesulfonamide?
The InChIKey is YDGWZTQORFEMST-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21NO2S/c1-8(2,3)7-9(4,5)10-13(6,11)12/h10H,7H2,1-6H3.
What are the key properties of N-(2,4,4-trimethylpentan-2-yl)methanesulfonamide?
N-(2,4,4-trimethylpentan-2-yl)methanesulfonamide has a molecular weight of 207.34 g/mol, XLogP of 1.75, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,4,4-trimethylpentan-2-yl)methanesulfonamide is sourced from PubChem (CID 19681856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).