C19H31NO2S — CID 19682030
2,3,5,6-tetramethyl-N-(3,3,5-trimethylcyclohexyl)benzenesulfonamide (PubChem CID 19682030) has the molecular formula C19H31NO2S and a molecular weight of 337.53 g/mol. Its IUPAC name is 2,3,5,6-tetramethyl-N-(3,3,5-trimethylcyclohexyl)benzenesulfonamide.
| Compound Name | 2,3,5,6-tetramethyl-N-(3,3,5-trimethylcyclohexyl)benzenesulfonamide |
|---|---|
| PubChem CID | 19682030 |
| Molecular Formula | C19H31NO2S |
| Molecular Weight | 337.53 g/mol |
| Exact Mass | 337.21 |
| IUPAC Name | 2,3,5,6-tetramethyl-N-(3,3,5-trimethylcyclohexyl)benzenesulfonamide |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)NC2CC(C)CC(C)(C)C2)c1C |
| InChI | InChI=1S/C19H31NO2S/c1-12-8-17(11-19(6,7)10-12)20-23(21,22)18-15(4)13(2)9-14(3)16(18)5/h9,12,17,20H,8,10-11H2,1-7H3 |
| InChIKey | COKNAEPMINWRHH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |