C16H23NO2S — CID 19682221
2,3,5,6-tetramethyl-N,N-bis(prop-2-enyl)benzenesulfonamide (PubChem CID 19682221) has the molecular formula C16H23NO2S and a molecular weight of 293.43 g/mol. Its IUPAC name is 2,3,5,6-tetramethyl-N,N-bis(prop-2-enyl)benzenesulfonamide.
| Compound Name | 2,3,5,6-tetramethyl-N,N-bis(prop-2-enyl)benzenesulfonamide |
|---|---|
| PubChem CID | 19682221 |
| Molecular Formula | C16H23NO2S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 2,3,5,6-tetramethyl-N,N-bis(prop-2-enyl)benzenesulfonamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1c(C)c(C)cc(C)c1C |
| InChI | InChI=1S/C16H23NO2S/c1-7-9-17(10-8-2)20(18,19)16-14(5)12(3)11-13(4)15(16)6/h7-8,11H,1-2,9-10H2,3-6H3 |
| InChIKey | OQICNRTWSKDEBL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|