C21H37NO2S — CID 19682365
N,N-dihexyl-2,4,6-trimethylbenzenesulfonamide (PubChem CID 19682365) has the molecular formula C21H37NO2S and a molecular weight of 367.60 g/mol. Its IUPAC name is N,N-dihexyl-2,4,6-trimethylbenzenesulfonamide.
| Compound Name | N,N-dihexyl-2,4,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 19682365 |
| Molecular Formula | C21H37NO2S |
| Molecular Weight | 367.60 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | N,N-dihexyl-2,4,6-trimethylbenzenesulfonamide |
| SMILES | CCCCCCN(CCCCCC)S(=O)(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C21H37NO2S/c1-6-8-10-12-14-22(15-13-11-9-7-2)25(23,24)21-19(4)16-18(3)17-20(21)5/h16-17H,6-15H2,1-5H3 |
| InChIKey | AEIHGEPLXFAFED-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.60 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|