C12H9Cl3N2O2S — CID 19683104
2,4,5-trichloro-N-(3-methyl-2-pyridinyl)benzenesulfonamide (PubChem CID 19683104) has the molecular formula C12H9Cl3N2O2S and a molecular weight of 351.64 g/mol. Its IUPAC name is 2,4,5-trichloro-N-(3-methyl-2-pyridinyl)benzenesulfonamide.
| Compound Name | 2,4,5-trichloro-N-(3-methyl-2-pyridinyl)benzenesulfonamide |
|---|---|
| PubChem CID | 19683104 |
| Molecular Formula | C12H9Cl3N2O2S |
| Molecular Weight | 351.64 g/mol |
| Exact Mass | 349.95 |
| IUPAC Name | 2,4,5-trichloro-N-(3-methyl-2-pyridinyl)benzenesulfonamide |
| SMILES | Cc1cccnc1NS(=O)(=O)c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H9Cl3N2O2S/c1-7-3-2-4-16-12(7)17-20(18,19)11-6-9(14)8(13)5-10(11)15/h2-6H,1H3,(H,16,17) |
| InChIKey | UUSYISAZODSUJC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.64 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|