C7H13N3O2S — CID 19684304
1-ethyl-N,3-dimethylpyrazole-4-sulfonamide (PubChem CID 19684304) has the molecular formula C7H13N3O2S and a molecular weight of 203.27 g/mol. Its IUPAC name is 1-ethyl-N,3-dimethylpyrazole-4-sulfonamide.
| Compound Name | 1-ethyl-N,3-dimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 19684304 |
| Molecular Formula | C7H13N3O2S |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 1-ethyl-N,3-dimethylpyrazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)NC)c(C)n1 |
| InChI | InChI=1S/C7H13N3O2S/c1-4-10-5-7(6(2)9-10)13(11,12)8-3/h5,8H,4H2,1-3H3 |
| InChIKey | IRDGSEYLPOLNMI-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |