C24H34N2O4S2 — CID 19684674
1-(4-tert-butylphenyl)sulfonyl-4-[4-(2-methylpropyl)phenyl]sulfonylpiperazine (PubChem CID 19684674) has the molecular formula C24H34N2O4S2 and a molecular weight of 478.68 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)sulfonyl-4-[4-(2-methylpropyl)phenyl]sulfonylpiperazine.
| Compound Name | 1-(4-tert-butylphenyl)sulfonyl-4-[4-(2-methylpropyl)phenyl]sulfonylpiperazine |
|---|---|
| PubChem CID | 19684674 |
| Molecular Formula | C24H34N2O4S2 |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | 1-(4-tert-butylphenyl)sulfonyl-4-[4-(2-methylpropyl)phenyl]sulfonylpiperazine |
| SMILES | CC(C)Cc1ccc(S(=O)(=O)N2CCN(S(=O)(=O)c3ccc(C(C)(C)C)cc3)CC2)cc1 |
| InChI | InChI=1S/C24H34N2O4S2/c1-19(2)18-20-6-10-22(11-7-20)31(27,28)25-14-16-26(17-15-25)32(29,30)23-12-8-21(9-13-23)24(3,4)5/h6-13,19H,14-18H2,1-5H3 |
| InChIKey | YXLQMLCUSSUGHW-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |