About N-cyclopentyl-2-methyl-2,3-dihydroindole-1-carbothioamide
N-cyclopentyl-2-methyl-2,3-dihydroindole-1-carbothioamide (PubChem CID 19686716) has the molecular formula C15H20N2S
and a molecular weight of 260.41 g/mol. Its IUPAC name is N-cyclopentyl-2-methyl-2,3-dihydroindole-1-carbothioamide.
Molecular Properties
| Compound Name | N-cyclopentyl-2-methyl-2,3-dihydroindole-1-carbothioamide |
| PubChem CID | 19686716 |
| Molecular Formula | C15H20N2S |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | N-cyclopentyl-2-methyl-2,3-dihydroindole-1-carbothioamide |
| SMILES | CC1Cc2ccccc2N1C(=S)NC1CCCC1 |
| InChI | InChI=1S/C15H20N2S/c1-11-10-12-6-2-5-9-14(12)17(11)15(18)16-13-7-3-4-8-13/h2,5-6,9,11,13H,3-4,7-8,10H2,1H3,(H,16,18) |
| InChIKey | XCERKRJAUNOPEE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopentyl-2-methyl-2,3-dihydroindole-1-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-2-methyl-2,3-dihydroindole-1-carbothioamide?
The IUPAC name of N-cyclopentyl-2-methyl-2,3-dihydroindole-1-carbothioamide (CID 19686716) is N-cyclopentyl-2-methyl-2,3-dihydroindole-1-carbothioamide.
What is the SMILES notation for N-cyclopentyl-2-methyl-2,3-dihydroindole-1-carbothioamide?
The canonical SMILES for N-cyclopentyl-2-methyl-2,3-dihydroindole-1-carbothioamide is CC1Cc2ccccc2N1C(=S)NC1CCCC1.
What is the InChIKey of N-cyclopentyl-2-methyl-2,3-dihydroindole-1-carbothioamide?
The InChIKey is XCERKRJAUNOPEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2S/c1-11-10-12-6-2-5-9-14(12)17(11)15(18)16-13-7-3-4-8-13/h2,5-6,9,11,13H,3-4,7-8,10H2,1H3,(H,16,18).
What are the key properties of N-cyclopentyl-2-methyl-2,3-dihydroindole-1-carbothioamide?
N-cyclopentyl-2-methyl-2,3-dihydroindole-1-carbothioamide has a molecular weight of 260.41 g/mol, XLogP of 3.25, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-2-methyl-2,3-dihydroindole-1-carbothioamide is sourced from PubChem (CID 19686716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).