About 1-cyclopropyl-3-(1,2-oxazol-3-yl)thiourea
1-cyclopropyl-3-(1,2-oxazol-3-yl)thiourea (PubChem CID 19686896) has the molecular formula C7H9N3OS
and a molecular weight of 183.24 g/mol. Its IUPAC name is 1-cyclopropyl-3-(1,2-oxazol-3-yl)thiourea.
Molecular Properties
| Compound Name | 1-cyclopropyl-3-(1,2-oxazol-3-yl)thiourea |
| PubChem CID | 19686896 |
| Molecular Formula | C7H9N3OS |
| Molecular Weight | 183.24 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 1-cyclopropyl-3-(1,2-oxazol-3-yl)thiourea |
| SMILES | S=C(Nc1ccon1)NC1CC1 |
| InChI | InChI=1S/C7H9N3OS/c12-7(8-5-1-2-5)9-6-3-4-11-10-6/h3-5H,1-2H2,(H2,8,9,10,12) |
| InChIKey | YANJATKSHSJWRY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 50.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.24 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopropyl-3-(1,2-oxazol-3-yl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-3-(1,2-oxazol-3-yl)thiourea?
The IUPAC name of 1-cyclopropyl-3-(1,2-oxazol-3-yl)thiourea (CID 19686896) is 1-cyclopropyl-3-(1,2-oxazol-3-yl)thiourea.
What is the SMILES notation for 1-cyclopropyl-3-(1,2-oxazol-3-yl)thiourea?
The canonical SMILES for 1-cyclopropyl-3-(1,2-oxazol-3-yl)thiourea is S=C(Nc1ccon1)NC1CC1.
What is the InChIKey of 1-cyclopropyl-3-(1,2-oxazol-3-yl)thiourea?
The InChIKey is YANJATKSHSJWRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3OS/c12-7(8-5-1-2-5)9-6-3-4-11-10-6/h3-5H,1-2H2,(H2,8,9,10,12).
What are the key properties of 1-cyclopropyl-3-(1,2-oxazol-3-yl)thiourea?
1-cyclopropyl-3-(1,2-oxazol-3-yl)thiourea has a molecular weight of 183.24 g/mol, XLogP of 1.12, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-3-(1,2-oxazol-3-yl)thiourea is sourced from PubChem (CID 19686896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).