About 1-(3-methoxypropyl)-3-(1,2-oxazol-3-yl)thiourea
1-(3-methoxypropyl)-3-(1,2-oxazol-3-yl)thiourea (PubChem CID 19686898) has the molecular formula C8H13N3O2S
and a molecular weight of 215.28 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-3-(1,2-oxazol-3-yl)thiourea.
Molecular Properties
| Compound Name | 1-(3-methoxypropyl)-3-(1,2-oxazol-3-yl)thiourea |
| PubChem CID | 19686898 |
| Molecular Formula | C8H13N3O2S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 1-(3-methoxypropyl)-3-(1,2-oxazol-3-yl)thiourea |
| SMILES | COCCCNC(=S)Nc1ccon1 |
| InChI | InChI=1S/C8H13N3O2S/c1-12-5-2-4-9-8(14)10-7-3-6-13-11-7/h3,6H,2,4-5H2,1H3,(H2,9,10,11,14) |
| InChIKey | IANZJPHAOFVWBX-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 59.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-methoxypropyl)-3-(1,2-oxazol-3-yl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methoxypropyl)-3-(1,2-oxazol-3-yl)thiourea?
The IUPAC name of 1-(3-methoxypropyl)-3-(1,2-oxazol-3-yl)thiourea (CID 19686898) is 1-(3-methoxypropyl)-3-(1,2-oxazol-3-yl)thiourea.
What is the SMILES notation for 1-(3-methoxypropyl)-3-(1,2-oxazol-3-yl)thiourea?
The canonical SMILES for 1-(3-methoxypropyl)-3-(1,2-oxazol-3-yl)thiourea is COCCCNC(=S)Nc1ccon1.
What is the InChIKey of 1-(3-methoxypropyl)-3-(1,2-oxazol-3-yl)thiourea?
The InChIKey is IANZJPHAOFVWBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O2S/c1-12-5-2-4-9-8(14)10-7-3-6-13-11-7/h3,6H,2,4-5H2,1H3,(H2,9,10,11,14).
What are the key properties of 1-(3-methoxypropyl)-3-(1,2-oxazol-3-yl)thiourea?
1-(3-methoxypropyl)-3-(1,2-oxazol-3-yl)thiourea has a molecular weight of 215.28 g/mol, XLogP of 1.00, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methoxypropyl)-3-(1,2-oxazol-3-yl)thiourea is sourced from PubChem (CID 19686898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).