C10H17NO — CID 19688337
N,N-bis(but-1-en-2-yl)acetamide (PubChem CID 19688337) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is N,N-bis(but-1-en-2-yl)acetamide.
| Compound Name | N,N-bis(but-1-en-2-yl)acetamide |
|---|---|
| PubChem CID | 19688337 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | N,N-bis(but-1-en-2-yl)acetamide |
| SMILES | C=C(CC)N(C(=C)CC)C(C)=O |
| InChI | InChI=1S/C10H17NO/c1-6-8(3)11(10(5)12)9(4)7-2/h3-4,6-7H2,1-2,5H3 |
| InChIKey | ORIGMSIYFRIJAM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |