C18H17NO5 — CID 19688479
4-(3,4-dioxocyclohexa-1,5-dien-1-yl)-2-(4-methoxyphenyl)pyrrolidine-3-carboxylic acid (PubChem CID 19688479) has the molecular formula C18H17NO5 and a molecular weight of 327.34 g/mol. Its IUPAC name is 4-(3,4-dioxocyclohexa-1,5-dien-1-yl)-2-(4-methoxyphenyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 4-(3,4-dioxocyclohexa-1,5-dien-1-yl)-2-(4-methoxyphenyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 19688479 |
| Molecular Formula | C18H17NO5 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 4-(3,4-dioxocyclohexa-1,5-dien-1-yl)-2-(4-methoxyphenyl)pyrrolidine-3-carboxylic acid |
| SMILES | COc1ccc(C2NCC(C3=CC(=O)C(=O)C=C3)C2C(=O)O)cc1 |
| InChI | InChI=1S/C18H17NO5/c1-24-12-5-2-10(3-6-12)17-16(18(22)23)13(9-19-17)11-4-7-14(20)15(21)8-11/h2-8,13,16-17,19H,9H2,1H3,(H,22,23) |
| InChIKey | OJGJGWCJSVTTFR-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|