C7H12F6OSi — CID 19688985
2,2,3,3,4,4-hexafluorobutoxy(trimethyl)silane (PubChem CID 19688985) has the molecular formula C7H12F6OSi and a molecular weight of 254.25 g/mol. Its IUPAC name is 2,2,3,3,4,4-hexafluorobutoxy(trimethyl)silane.
| Compound Name | 2,2,3,3,4,4-hexafluorobutoxy(trimethyl)silane |
|---|---|
| PubChem CID | 19688985 |
| Molecular Formula | C7H12F6OSi |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 2,2,3,3,4,4-hexafluorobutoxy(trimethyl)silane |
| SMILES | C[Si](C)(C)OCC(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C7H12F6OSi/c1-15(2,3)14-4-6(10,11)7(12,13)5(8)9/h5H,4H2,1-3H3 |
| InChIKey | KCLJVURTUGWQSX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|