About 2H-pyran-3,4,5-triol
2H-pyran-3,4,5-triol (PubChem CID 19689120) has the molecular formula C5H6O4
and a molecular weight of 130.10 g/mol. Its IUPAC name is 2H-pyran-3,4,5-triol.
Molecular Properties
| Compound Name | 2H-pyran-3,4,5-triol |
| PubChem CID | 19689120 |
| Molecular Formula | C5H6O4 |
| Molecular Weight | 130.10 g/mol |
| Exact Mass | 130.03 |
| IUPAC Name | 2H-pyran-3,4,5-triol |
| SMILES | OC1=COCC(O)=C1O |
| InChI | InChI=1S/C5H6O4/c6-3-1-9-2-4(7)5(3)8/h1,6-8H,2H2 |
| InChIKey | WVBZJYPLDKJFPH-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.10 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2H-pyran-3,4,5-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-pyran-3,4,5-triol?
The IUPAC name of 2H-pyran-3,4,5-triol (CID 19689120) is 2H-pyran-3,4,5-triol.
What is the SMILES notation for 2H-pyran-3,4,5-triol?
The canonical SMILES for 2H-pyran-3,4,5-triol is OC1=COCC(O)=C1O.
What is the InChIKey of 2H-pyran-3,4,5-triol?
The InChIKey is WVBZJYPLDKJFPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O4/c6-3-1-9-2-4(7)5(3)8/h1,6-8H,2H2.
What are the key properties of 2H-pyran-3,4,5-triol?
2H-pyran-3,4,5-triol has a molecular weight of 130.10 g/mol, XLogP of 0.74, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-pyran-3,4,5-triol is sourced from PubChem (CID 19689120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).