About 2-(3,4-dimethoxyphenyl)sulfonyl-3-phenyl-3H-isoindol-1-one
2-(3,4-dimethoxyphenyl)sulfonyl-3-phenyl-3H-isoindol-1-one (PubChem CID 19689656) has the molecular formula C22H19NO5S
and a molecular weight of 409.46 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)sulfonyl-3-phenyl-3H-isoindol-1-one.
Molecular Properties
| Compound Name | 2-(3,4-dimethoxyphenyl)sulfonyl-3-phenyl-3H-isoindol-1-one |
| PubChem CID | 19689656 |
| Molecular Formula | C22H19NO5S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)sulfonyl-3-phenyl-3H-isoindol-1-one |
| SMILES | COc1ccc(S(=O)(=O)N2C(=O)c3ccccc3C2c2ccccc2)cc1OC |
| InChI | InChI=1S/C22H19NO5S/c1-27-19-13-12-16(14-20(19)28-2)29(25,26)23-21(15-8-4-3-5-9-15)17-10-6-7-11-18(17)22(23)24/h3-14,21H,1-2H3 |
| InChIKey | RJIGULYTXCAXAA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3,4-dimethoxyphenyl)sulfonyl-3-phenyl-3H-isoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethoxyphenyl)sulfonyl-3-phenyl-3H-isoindol-1-one?
The IUPAC name of 2-(3,4-dimethoxyphenyl)sulfonyl-3-phenyl-3H-isoindol-1-one (CID 19689656) is 2-(3,4-dimethoxyphenyl)sulfonyl-3-phenyl-3H-isoindol-1-one.
What is the SMILES notation for 2-(3,4-dimethoxyphenyl)sulfonyl-3-phenyl-3H-isoindol-1-one?
The canonical SMILES for 2-(3,4-dimethoxyphenyl)sulfonyl-3-phenyl-3H-isoindol-1-one is COc1ccc(S(=O)(=O)N2C(=O)c3ccccc3C2c2ccccc2)cc1OC.
What is the InChIKey of 2-(3,4-dimethoxyphenyl)sulfonyl-3-phenyl-3H-isoindol-1-one?
The InChIKey is RJIGULYTXCAXAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19NO5S/c1-27-19-13-12-16(14-20(19)28-2)29(25,26)23-21(15-8-4-3-5-9-15)17-10-6-7-11-18(17)22(23)24/h3-14,21H,1-2H3.
What are the key properties of 2-(3,4-dimethoxyphenyl)sulfonyl-3-phenyl-3H-isoindol-1-one?
2-(3,4-dimethoxyphenyl)sulfonyl-3-phenyl-3H-isoindol-1-one has a molecular weight of 409.46 g/mol, XLogP of 3.64, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethoxyphenyl)sulfonyl-3-phenyl-3H-isoindol-1-one is sourced from PubChem (CID 19689656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).