C19H18N2O3 — CID 19690194
3-(3,4-dimethoxyphenyl)-3-(3-oxo-1H-isoindol-2-yl)propanenitrile (PubChem CID 19690194) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-3-(3-oxo-1H-isoindol-2-yl)propanenitrile.
| Compound Name | 3-(3,4-dimethoxyphenyl)-3-(3-oxo-1H-isoindol-2-yl)propanenitrile |
|---|---|
| PubChem CID | 19690194 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-3-(3-oxo-1H-isoindol-2-yl)propanenitrile |
| SMILES | COc1ccc(C(CC#N)N2Cc3ccccc3C2=O)cc1OC |
| InChI | InChI=1S/C19H18N2O3/c1-23-17-8-7-13(11-18(17)24-2)16(9-10-20)21-12-14-5-3-4-6-15(14)19(21)22/h3-8,11,16H,9,12H2,1-2H3 |
| InChIKey | WIRDNTTXRMQVIC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |