About bis(bicyclo[2.2.1]hepta-2,5-diene);tetrachlororuthenium
bis(bicyclo[2.2.1]hepta-2,5-diene);tetrachlororuthenium (PubChem CID 19690374) has the molecular formula C14H16Cl4Ru
and a molecular weight of 427.16 g/mol. Its IUPAC name is bis(bicyclo[2.2.1]hepta-2,5-diene);tetrachlororuthenium.
Molecular Properties
| Compound Name | bis(bicyclo[2.2.1]hepta-2,5-diene);tetrachlororuthenium |
| PubChem CID | 19690374 |
| Molecular Formula | C14H16Cl4Ru |
| Molecular Weight | 427.16 g/mol |
| Exact Mass | 425.90 |
| IUPAC Name | bis(bicyclo[2.2.1]hepta-2,5-diene);tetrachlororuthenium |
| SMILES | C1=CC2C=CC1C2.C1=CC2C=CC1C2.Cl[Ru](Cl)(Cl)Cl |
| InChI | InChI=1S/2C7H8.4ClH.Ru/c2*1-2-7-4-3-6(1)5-7;;;;;/h2*1-4,6-7H,5H2;4*1H;/q;;;;;;+4/p-4 |
| InChIKey | FREJSLDYEMGXEL-UHFFFAOYSA-J |
| XLogP | 6.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.16 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis(bicyclo[2.2.1]hepta-2,5-diene);tetrachlororuthenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(bicyclo[2.2.1]hepta-2,5-diene);tetrachlororuthenium?
The IUPAC name of bis(bicyclo[2.2.1]hepta-2,5-diene);tetrachlororuthenium (CID 19690374) is bis(bicyclo[2.2.1]hepta-2,5-diene);tetrachlororuthenium.
What is the SMILES notation for bis(bicyclo[2.2.1]hepta-2,5-diene);tetrachlororuthenium?
The canonical SMILES for bis(bicyclo[2.2.1]hepta-2,5-diene);tetrachlororuthenium is C1=CC2C=CC1C2.C1=CC2C=CC1C2.Cl[Ru](Cl)(Cl)Cl.
What is the InChIKey of bis(bicyclo[2.2.1]hepta-2,5-diene);tetrachlororuthenium?
The InChIKey is FREJSLDYEMGXEL-UHFFFAOYSA-J. The full InChI is InChI=1S/2C7H8.4ClH.Ru/c2*1-2-7-4-3-6(1)5-7;;;;;/h2*1-4,6-7H,5H2;4*1H;/q;;;;;;+4/p-4.
What are the key properties of bis(bicyclo[2.2.1]hepta-2,5-diene);tetrachlororuthenium?
bis(bicyclo[2.2.1]hepta-2,5-diene);tetrachlororuthenium has a molecular weight of 427.16 g/mol, XLogP of 6.25, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(bicyclo[2.2.1]hepta-2,5-diene);tetrachlororuthenium is sourced from PubChem (CID 19690374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).