C20H19N3O5 — CID 19691058
16-(4-carboxybutyl)-16-methyl-7-oxo-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10,12,14-hexaene-4-carboxylic acid (PubChem CID 19691058) has the molecular formula C20H19N3O5 and a molecular weight of 381.39 g/mol. Its IUPAC name is 16-(4-carboxybutyl)-16-methyl-7-oxo-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10,12,14-hexaene-4-carboxylic acid.
| Compound Name | 16-(4-carboxybutyl)-16-methyl-7-oxo-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10,12,14-hexaene-4-carboxylic acid |
|---|---|
| PubChem CID | 19691058 |
| Molecular Formula | C20H19N3O5 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 16-(4-carboxybutyl)-16-methyl-7-oxo-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10,12,14-hexaene-4-carboxylic acid |
| SMILES | CC1(CCCCC(=O)O)c2ccccc2-c2[nH]c(=O)c3nc(C(=O)O)cn3c21 |
| InChI | InChI=1S/C20H19N3O5/c1-20(9-5-4-8-14(24)25)12-7-3-2-6-11(12)15-16(20)23-10-13(19(27)28)21-17(23)18(26)22-15/h2-3,6-7,10H,4-5,8-9H2,1H3,(H,22,26)(H,24,25)(H,27,28) |
| InChIKey | QZARVXGDUOQXJD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|