1,1,2-trifluoroethanesulfonyl chloride

C2H2ClF3O2S — CID 19691189

IUPAC1,1,2-trifluoroethanesulfonyl chloride
SMILESO=S(=O)(Cl)C(F)(F)CF
InChIInChI=1S/C2H2ClF3O2S/c3-9(7,8)2(5,6)1-4/h1H2
InChIKeyTZZMCTTVTAAXAG-UHFFFAOYSA-N
MW182.55 g/mol
LogP1.12
Rot. Bonds2

About 1,1,2-trifluoroethanesulfonyl chloride

1,1,2-trifluoroethanesulfonyl chloride (PubChem CID 19691189) has the molecular formula C2H2ClF3O2S and a molecular weight of 182.55 g/mol. Its IUPAC name is 1,1,2-trifluoroethanesulfonyl chloride.

Molecular Properties

Compound Name1,1,2-trifluoroethanesulfonyl chloride
PubChem CID19691189
Molecular FormulaC2H2ClF3O2S
Molecular Weight182.55 g/mol
Exact Mass181.94
IUPAC Name1,1,2-trifluoroethanesulfonyl chloride
SMILESO=S(=O)(Cl)C(F)(F)CF
InChIInChI=1S/C2H2ClF3O2S/c3-9(7,8)2(5,6)1-4/h1H2
InChIKeyTZZMCTTVTAAXAG-UHFFFAOYSA-N
XLogP1.12
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.55
LogP ≤ 51.12
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze 1,1,2-trifluoroethanesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,1,2-trifluoroethanesulfonyl chloride?
The IUPAC name of 1,1,2-trifluoroethanesulfonyl chloride (CID 19691189) is 1,1,2-trifluoroethanesulfonyl chloride.
What is the SMILES notation for 1,1,2-trifluoroethanesulfonyl chloride?
The canonical SMILES for 1,1,2-trifluoroethanesulfonyl chloride is O=S(=O)(Cl)C(F)(F)CF.
What is the InChIKey of 1,1,2-trifluoroethanesulfonyl chloride?
The InChIKey is TZZMCTTVTAAXAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2ClF3O2S/c3-9(7,8)2(5,6)1-4/h1H2.
What are the key properties of 1,1,2-trifluoroethanesulfonyl chloride?
1,1,2-trifluoroethanesulfonyl chloride has a molecular weight of 182.55 g/mol, XLogP of 1.12, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,2-trifluoroethanesulfonyl chloride is sourced from PubChem (CID 19691189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).