C8H6ClF5N2 — CID 19691433
2-(2,3,4,5,6-pentafluorophenyl)ethanimidamide;hydrochloride (PubChem CID 19691433) has the molecular formula C8H6ClF5N2 and a molecular weight of 260.59 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentafluorophenyl)ethanimidamide;hydrochloride.
| Compound Name | 2-(2,3,4,5,6-pentafluorophenyl)ethanimidamide;hydrochloride |
|---|---|
| PubChem CID | 19691433 |
| Molecular Formula | C8H6ClF5N2 |
| Molecular Weight | 260.59 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | 2-(2,3,4,5,6-pentafluorophenyl)ethanimidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)Cc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C8H5F5N2.ClH/c9-4-2(1-3(14)15)5(10)7(12)8(13)6(4)11;/h1H2,(H3,14,15);1H |
| InChIKey | PWEIHTLMFGYQPK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.59 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|