C10H12F3N3 — CID 19691468
1-methyl-4-(2,3,5-trifluoro-4-pyridinyl)piperazine (PubChem CID 19691468) has the molecular formula C10H12F3N3 and a molecular weight of 231.22 g/mol. Its IUPAC name is 1-methyl-4-(2,3,5-trifluoro-4-pyridinyl)piperazine.
| Compound Name | 1-methyl-4-(2,3,5-trifluoro-4-pyridinyl)piperazine |
|---|---|
| PubChem CID | 19691468 |
| Molecular Formula | C10H12F3N3 |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 1-methyl-4-(2,3,5-trifluoro-4-pyridinyl)piperazine |
| SMILES | CN1CCN(c2c(F)cnc(F)c2F)CC1 |
| InChI | InChI=1S/C10H12F3N3/c1-15-2-4-16(5-3-15)9-7(11)6-14-10(13)8(9)12/h6H,2-5H2,1H3 |
| InChIKey | XFPXHWXEQOOUNJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|