C23H32N2O5S — CID 19691661
2-[1-[4-(4-carbamothioylphenyl)-2-methyl-4-oxobutanoyl]piperidin-4-yl]oxy-3,3-dimethylbutanoic acid (PubChem CID 19691661) has the molecular formula C23H32N2O5S and a molecular weight of 448.59 g/mol. Its IUPAC name is 2-[1-[4-(4-carbamothioylphenyl)-2-methyl-4-oxobutanoyl]piperidin-4-yl]oxy-3,3-dimethylbutanoic acid.
| Compound Name | 2-[1-[4-(4-carbamothioylphenyl)-2-methyl-4-oxobutanoyl]piperidin-4-yl]oxy-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 19691661 |
| Molecular Formula | C23H32N2O5S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 2-[1-[4-(4-carbamothioylphenyl)-2-methyl-4-oxobutanoyl]piperidin-4-yl]oxy-3,3-dimethylbutanoic acid |
| SMILES | CC(CC(=O)c1ccc(C(N)=S)cc1)C(=O)N1CCC(OC(C(=O)O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C23H32N2O5S/c1-14(13-18(26)15-5-7-16(8-6-15)20(24)31)21(27)25-11-9-17(10-12-25)30-19(22(28)29)23(2,3)4/h5-8,14,17,19H,9-13H2,1-4H3,(H2,24,31)(H,28,29) |
| InChIKey | INYWHSXQVXUWNB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|