About 5-chloro-2-(4,5-dihydro-1H-imidazol-2-yl)-1,3-dihydroisoindole
5-chloro-2-(4,5-dihydro-1H-imidazol-2-yl)-1,3-dihydroisoindole (PubChem CID 19691965) has the molecular formula C11H12ClN3
and a molecular weight of 221.69 g/mol. Its IUPAC name is 5-chloro-2-(4,5-dihydro-1H-imidazol-2-yl)-1,3-dihydroisoindole.
Molecular Properties
| Compound Name | 5-chloro-2-(4,5-dihydro-1H-imidazol-2-yl)-1,3-dihydroisoindole |
| PubChem CID | 19691965 |
| Molecular Formula | C11H12ClN3 |
| Molecular Weight | 221.69 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 5-chloro-2-(4,5-dihydro-1H-imidazol-2-yl)-1,3-dihydroisoindole |
| SMILES | Clc1ccc2c(c1)CN(C1=NCCN1)C2 |
| InChI | InChI=1S/C11H12ClN3/c12-10-2-1-8-6-15(7-9(8)5-10)11-13-3-4-14-11/h1-2,5H,3-4,6-7H2,(H,13,14) |
| InChIKey | YGIRSJGKYBEKKR-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.69 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-2-(4,5-dihydro-1H-imidazol-2-yl)-1,3-dihydroisoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-(4,5-dihydro-1H-imidazol-2-yl)-1,3-dihydroisoindole?
The IUPAC name of 5-chloro-2-(4,5-dihydro-1H-imidazol-2-yl)-1,3-dihydroisoindole (CID 19691965) is 5-chloro-2-(4,5-dihydro-1H-imidazol-2-yl)-1,3-dihydroisoindole.
What is the SMILES notation for 5-chloro-2-(4,5-dihydro-1H-imidazol-2-yl)-1,3-dihydroisoindole?
The canonical SMILES for 5-chloro-2-(4,5-dihydro-1H-imidazol-2-yl)-1,3-dihydroisoindole is Clc1ccc2c(c1)CN(C1=NCCN1)C2.
What is the InChIKey of 5-chloro-2-(4,5-dihydro-1H-imidazol-2-yl)-1,3-dihydroisoindole?
The InChIKey is YGIRSJGKYBEKKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClN3/c12-10-2-1-8-6-15(7-9(8)5-10)11-13-3-4-14-11/h1-2,5H,3-4,6-7H2,(H,13,14).
What are the key properties of 5-chloro-2-(4,5-dihydro-1H-imidazol-2-yl)-1,3-dihydroisoindole?
5-chloro-2-(4,5-dihydro-1H-imidazol-2-yl)-1,3-dihydroisoindole has a molecular weight of 221.69 g/mol, XLogP of 1.61, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-(4,5-dihydro-1H-imidazol-2-yl)-1,3-dihydroisoindole is sourced from PubChem (CID 19691965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).