About 2-(4,5-dihydro-1H-imidazol-2-yl)-4-(trifluoromethyl)-1,3-dihydroisoindole
2-(4,5-dihydro-1H-imidazol-2-yl)-4-(trifluoromethyl)-1,3-dihydroisoindole (PubChem CID 19691993) has the molecular formula C12H12F3N3
and a molecular weight of 255.24 g/mol. Its IUPAC name is 2-(4,5-dihydro-1H-imidazol-2-yl)-4-(trifluoromethyl)-1,3-dihydroisoindole.
Molecular Properties
| Compound Name | 2-(4,5-dihydro-1H-imidazol-2-yl)-4-(trifluoromethyl)-1,3-dihydroisoindole |
| PubChem CID | 19691993 |
| Molecular Formula | C12H12F3N3 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 2-(4,5-dihydro-1H-imidazol-2-yl)-4-(trifluoromethyl)-1,3-dihydroisoindole |
| SMILES | FC(F)(F)c1cccc2c1CN(C1=NCCN1)C2 |
| InChI | InChI=1S/C12H12F3N3/c13-12(14,15)10-3-1-2-8-6-18(7-9(8)10)11-16-4-5-17-11/h1-3H,4-7H2,(H,16,17) |
| InChIKey | DPJDHZXTYKFWCR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4,5-dihydro-1H-imidazol-2-yl)-4-(trifluoromethyl)-1,3-dihydroisoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dihydro-1H-imidazol-2-yl)-4-(trifluoromethyl)-1,3-dihydroisoindole?
The IUPAC name of 2-(4,5-dihydro-1H-imidazol-2-yl)-4-(trifluoromethyl)-1,3-dihydroisoindole (CID 19691993) is 2-(4,5-dihydro-1H-imidazol-2-yl)-4-(trifluoromethyl)-1,3-dihydroisoindole.
What is the SMILES notation for 2-(4,5-dihydro-1H-imidazol-2-yl)-4-(trifluoromethyl)-1,3-dihydroisoindole?
The canonical SMILES for 2-(4,5-dihydro-1H-imidazol-2-yl)-4-(trifluoromethyl)-1,3-dihydroisoindole is FC(F)(F)c1cccc2c1CN(C1=NCCN1)C2.
What is the InChIKey of 2-(4,5-dihydro-1H-imidazol-2-yl)-4-(trifluoromethyl)-1,3-dihydroisoindole?
The InChIKey is DPJDHZXTYKFWCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F3N3/c13-12(14,15)10-3-1-2-8-6-18(7-9(8)10)11-16-4-5-17-11/h1-3H,4-7H2,(H,16,17).
What are the key properties of 2-(4,5-dihydro-1H-imidazol-2-yl)-4-(trifluoromethyl)-1,3-dihydroisoindole?
2-(4,5-dihydro-1H-imidazol-2-yl)-4-(trifluoromethyl)-1,3-dihydroisoindole has a molecular weight of 255.24 g/mol, XLogP of 1.98, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dihydro-1H-imidazol-2-yl)-4-(trifluoromethyl)-1,3-dihydroisoindole is sourced from PubChem (CID 19691993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).