About 1-(1-aminoethoxy)ethanol;azane
1-(1-aminoethoxy)ethanol;azane (PubChem CID 19692086) has the molecular formula C4H14N2O2
and a molecular weight of 122.17 g/mol. Its IUPAC name is 1-(1-aminoethoxy)ethanol;azane.
Molecular Properties
| Compound Name | 1-(1-aminoethoxy)ethanol;azane |
| PubChem CID | 19692086 |
| Molecular Formula | C4H14N2O2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.11 |
| IUPAC Name | 1-(1-aminoethoxy)ethanol;azane |
| SMILES | CC(N)OC(C)O.N |
| InChI | InChI=1S/C4H11NO2.H3N/c1-3(5)7-4(2)6;/h3-4,6H,5H2,1-2H3;1H3 |
| InChIKey | OGCOQRWRNLZFPF-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 90.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-aminoethoxy)ethanol;azane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-aminoethoxy)ethanol;azane?
The IUPAC name of 1-(1-aminoethoxy)ethanol;azane (CID 19692086) is 1-(1-aminoethoxy)ethanol;azane.
What is the SMILES notation for 1-(1-aminoethoxy)ethanol;azane?
The canonical SMILES for 1-(1-aminoethoxy)ethanol;azane is CC(N)OC(C)O.N.
What is the InChIKey of 1-(1-aminoethoxy)ethanol;azane?
The InChIKey is OGCOQRWRNLZFPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11NO2.H3N/c1-3(5)7-4(2)6;/h3-4,6H,5H2,1-2H3;1H3.
What are the key properties of 1-(1-aminoethoxy)ethanol;azane?
1-(1-aminoethoxy)ethanol;azane has a molecular weight of 122.17 g/mol, XLogP of -0.19, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-aminoethoxy)ethanol;azane is sourced from PubChem (CID 19692086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).