C25H25N3O6 — CID 19692174
2-[[6-[3-(cyclohexylcarbamoyl)phenoxy]-3-hydroxyquinoline-2-carbonyl]amino]acetic acid (PubChem CID 19692174) has the molecular formula C25H25N3O6 and a molecular weight of 463.49 g/mol. Its IUPAC name is 2-[[6-[3-(cyclohexylcarbamoyl)phenoxy]-3-hydroxyquinoline-2-carbonyl]amino]acetic acid.
| Compound Name | 2-[[6-[3-(cyclohexylcarbamoyl)phenoxy]-3-hydroxyquinoline-2-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 19692174 |
| Molecular Formula | C25H25N3O6 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 2-[[6-[3-(cyclohexylcarbamoyl)phenoxy]-3-hydroxyquinoline-2-carbonyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1nc2ccc(Oc3cccc(C(=O)NC4CCCCC4)c3)cc2cc1O |
| InChI | InChI=1S/C25H25N3O6/c29-21-13-16-12-19(9-10-20(16)28-23(21)25(33)26-14-22(30)31)34-18-8-4-5-15(11-18)24(32)27-17-6-2-1-3-7-17/h4-5,8-13,17,29H,1-3,6-7,14H2,(H,26,33)(H,27,32)(H,30,31) |
| InChIKey | COHIRNOMXPGGCJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 137.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |