C15H9ClF7NO3 — CID 19692185
1-[7-chloro-6-(2,2,3,3,4,4,4-heptafluorobutoxy)-3-hydroxyquinolin-2-yl]ethanone (PubChem CID 19692185) has the molecular formula C15H9ClF7NO3 and a molecular weight of 419.68 g/mol. Its IUPAC name is 1-[7-chloro-6-(2,2,3,3,4,4,4-heptafluorobutoxy)-3-hydroxyquinolin-2-yl]ethanone.
| Compound Name | 1-[7-chloro-6-(2,2,3,3,4,4,4-heptafluorobutoxy)-3-hydroxyquinolin-2-yl]ethanone |
|---|---|
| PubChem CID | 19692185 |
| Molecular Formula | C15H9ClF7NO3 |
| Molecular Weight | 419.68 g/mol |
| Exact Mass | 419.02 |
| IUPAC Name | 1-[7-chloro-6-(2,2,3,3,4,4,4-heptafluorobutoxy)-3-hydroxyquinolin-2-yl]ethanone |
| SMILES | CC(=O)c1nc2cc(Cl)c(OCC(F)(F)C(F)(F)C(F)(F)F)cc2cc1O |
| InChI | InChI=1S/C15H9ClF7NO3/c1-6(25)12-10(26)2-7-3-11(8(16)4-9(7)24-12)27-5-13(17,18)14(19,20)15(21,22)23/h2-4,26H,5H2,1H3 |
| InChIKey | PBBZBCJJWDJPDV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.68 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|