C22H15ClF7NO3 — CID 19692188
1-[7-chloro-6-(2,2,3,3,4,4,4-heptafluorobutoxy)-3-phenylmethoxyquinolin-2-yl]ethanone (PubChem CID 19692188) has the molecular formula C22H15ClF7NO3 and a molecular weight of 509.81 g/mol. Its IUPAC name is 1-[7-chloro-6-(2,2,3,3,4,4,4-heptafluorobutoxy)-3-phenylmethoxyquinolin-2-yl]ethanone.
| Compound Name | 1-[7-chloro-6-(2,2,3,3,4,4,4-heptafluorobutoxy)-3-phenylmethoxyquinolin-2-yl]ethanone |
|---|---|
| PubChem CID | 19692188 |
| Molecular Formula | C22H15ClF7NO3 |
| Molecular Weight | 509.81 g/mol |
| Exact Mass | 509.06 |
| IUPAC Name | 1-[7-chloro-6-(2,2,3,3,4,4,4-heptafluorobutoxy)-3-phenylmethoxyquinolin-2-yl]ethanone |
| SMILES | CC(=O)c1nc2cc(Cl)c(OCC(F)(F)C(F)(F)C(F)(F)F)cc2cc1OCc1ccccc1 |
| InChI | InChI=1S/C22H15ClF7NO3/c1-12(32)19-18(33-10-13-5-3-2-4-6-13)8-14-7-17(15(23)9-16(14)31-19)34-11-20(24,25)21(26,27)22(28,29)30/h2-9H,10-11H2,1H3 |
| InChIKey | SCZOKAULUZUGGS-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.81 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|