C15H10ClF5N2O5 — CID 19692201
2-[[7-chloro-3-hydroxy-6-(2,2,3,3,3-pentafluoropropoxy)quinoline-2-carbonyl]amino]acetic acid (PubChem CID 19692201) has the molecular formula C15H10ClF5N2O5 and a molecular weight of 428.70 g/mol. Its IUPAC name is 2-[[7-chloro-3-hydroxy-6-(2,2,3,3,3-pentafluoropropoxy)quinoline-2-carbonyl]amino]acetic acid.
| Compound Name | 2-[[7-chloro-3-hydroxy-6-(2,2,3,3,3-pentafluoropropoxy)quinoline-2-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 19692201 |
| Molecular Formula | C15H10ClF5N2O5 |
| Molecular Weight | 428.70 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | 2-[[7-chloro-3-hydroxy-6-(2,2,3,3,3-pentafluoropropoxy)quinoline-2-carbonyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1nc2cc(Cl)c(OCC(F)(F)C(F)(F)F)cc2cc1O |
| InChI | InChI=1S/C15H10ClF5N2O5/c16-7-3-8-6(2-10(7)28-5-14(17,18)15(19,20)21)1-9(24)12(23-8)13(27)22-4-11(25)26/h1-3,24H,4-5H2,(H,22,27)(H,25,26) |
| InChIKey | JQGJKVNQBSYSNM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.70 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|