C20H15F4NO4 — CID 19692204
3-phenylmethoxy-6-(2,2,3,3-tetrafluoropropoxy)quinoline-2-carboxylic acid (PubChem CID 19692204) has the molecular formula C20H15F4NO4 and a molecular weight of 409.34 g/mol. Its IUPAC name is 3-phenylmethoxy-6-(2,2,3,3-tetrafluoropropoxy)quinoline-2-carboxylic acid.
| Compound Name | 3-phenylmethoxy-6-(2,2,3,3-tetrafluoropropoxy)quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 19692204 |
| Molecular Formula | C20H15F4NO4 |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 3-phenylmethoxy-6-(2,2,3,3-tetrafluoropropoxy)quinoline-2-carboxylic acid |
| SMILES | O=C(O)c1nc2ccc(OCC(F)(F)C(F)F)cc2cc1OCc1ccccc1 |
| InChI | InChI=1S/C20H15F4NO4/c21-19(22)20(23,24)11-29-14-6-7-15-13(8-14)9-16(17(25-15)18(26)27)28-10-12-4-2-1-3-5-12/h1-9,19H,10-11H2,(H,26,27) |
| InChIKey | OTJWFYTYRYVRQX-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|