C16H19NO6 — CID 19692212
3-(5-butoxy-2-nitrobenzoyl)pentane-2,4-dione (PubChem CID 19692212) has the molecular formula C16H19NO6 and a molecular weight of 321.33 g/mol. Its IUPAC name is 3-(5-butoxy-2-nitrobenzoyl)pentane-2,4-dione.
| Compound Name | 3-(5-butoxy-2-nitrobenzoyl)pentane-2,4-dione |
|---|---|
| PubChem CID | 19692212 |
| Molecular Formula | C16H19NO6 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 3-(5-butoxy-2-nitrobenzoyl)pentane-2,4-dione |
| SMILES | CCCCOc1ccc([N+](=O)[O-])c(C(=O)C(C(C)=O)C(C)=O)c1 |
| InChI | InChI=1S/C16H19NO6/c1-4-5-8-23-12-6-7-14(17(21)22)13(9-12)16(20)15(10(2)18)11(3)19/h6-7,9,15H,4-5,8H2,1-3H3 |
| InChIKey | AURDQYMQRHNONV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|