C16H11F8NO3 — CID 19692218
1-[3-hydroxy-6-(2,2,3,3,4,4,5,5-octafluoropentoxy)quinolin-2-yl]ethanone (PubChem CID 19692218) has the molecular formula C16H11F8NO3 and a molecular weight of 417.25 g/mol. Its IUPAC name is 1-[3-hydroxy-6-(2,2,3,3,4,4,5,5-octafluoropentoxy)quinolin-2-yl]ethanone.
| Compound Name | 1-[3-hydroxy-6-(2,2,3,3,4,4,5,5-octafluoropentoxy)quinolin-2-yl]ethanone |
|---|---|
| PubChem CID | 19692218 |
| Molecular Formula | C16H11F8NO3 |
| Molecular Weight | 417.25 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | 1-[3-hydroxy-6-(2,2,3,3,4,4,5,5-octafluoropentoxy)quinolin-2-yl]ethanone |
| SMILES | CC(=O)c1nc2ccc(OCC(F)(F)C(F)(F)C(F)(F)C(F)F)cc2cc1O |
| InChI | InChI=1S/C16H11F8NO3/c1-7(26)12-11(27)5-8-4-9(2-3-10(8)25-12)28-6-14(19,20)16(23,24)15(21,22)13(17)18/h2-5,13,27H,6H2,1H3 |
| InChIKey | LBJHMKIIQJOGBJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.25 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|