C23H17F8NO3 — CID 19692225
1-[6-(2,2,3,3,4,4,5,5-octafluoropentoxy)-3-phenylmethoxyquinolin-2-yl]ethanone (PubChem CID 19692225) has the molecular formula C23H17F8NO3 and a molecular weight of 507.38 g/mol. Its IUPAC name is 1-[6-(2,2,3,3,4,4,5,5-octafluoropentoxy)-3-phenylmethoxyquinolin-2-yl]ethanone.
| Compound Name | 1-[6-(2,2,3,3,4,4,5,5-octafluoropentoxy)-3-phenylmethoxyquinolin-2-yl]ethanone |
|---|---|
| PubChem CID | 19692225 |
| Molecular Formula | C23H17F8NO3 |
| Molecular Weight | 507.38 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | 1-[6-(2,2,3,3,4,4,5,5-octafluoropentoxy)-3-phenylmethoxyquinolin-2-yl]ethanone |
| SMILES | CC(=O)c1nc2ccc(OCC(F)(F)C(F)(F)C(F)(F)C(F)F)cc2cc1OCc1ccccc1 |
| InChI | InChI=1S/C23H17F8NO3/c1-13(33)19-18(34-11-14-5-3-2-4-6-14)10-15-9-16(7-8-17(15)32-19)35-12-21(26,27)23(30,31)22(28,29)20(24)25/h2-10,20H,11-12H2,1H3 |
| InChIKey | IAFBERKGDTYIPC-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.38 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|