C22H15F8NO4 — CID 19692266
6-(2,2,3,3,4,4,5,5-octafluoropentoxy)-3-phenylmethoxyquinoline-2-carboxylic acid (PubChem CID 19692266) has the molecular formula C22H15F8NO4 and a molecular weight of 509.35 g/mol. Its IUPAC name is 6-(2,2,3,3,4,4,5,5-octafluoropentoxy)-3-phenylmethoxyquinoline-2-carboxylic acid.
| Compound Name | 6-(2,2,3,3,4,4,5,5-octafluoropentoxy)-3-phenylmethoxyquinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 19692266 |
| Molecular Formula | C22H15F8NO4 |
| Molecular Weight | 509.35 g/mol |
| Exact Mass | 509.09 |
| IUPAC Name | 6-(2,2,3,3,4,4,5,5-octafluoropentoxy)-3-phenylmethoxyquinoline-2-carboxylic acid |
| SMILES | O=C(O)c1nc2ccc(OCC(F)(F)C(F)(F)C(F)(F)C(F)F)cc2cc1OCc1ccccc1 |
| InChI | InChI=1S/C22H15F8NO4/c23-19(24)21(27,28)22(29,30)20(25,26)11-35-14-6-7-15-13(8-14)9-16(17(31-15)18(32)33)34-10-12-4-2-1-3-5-12/h1-9,19H,10-11H2,(H,32,33) |
| InChIKey | FRGGQUVDTHUMMK-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.35 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|