About 6-hydroxy-1,3-dimethyl-3H-indol-2-one
6-hydroxy-1,3-dimethyl-3H-indol-2-one (PubChem CID 19692931) has the molecular formula C10H11NO2
and a molecular weight of 177.20 g/mol. Its IUPAC name is 6-hydroxy-1,3-dimethyl-3H-indol-2-one.
Molecular Properties
| Compound Name | 6-hydroxy-1,3-dimethyl-3H-indol-2-one |
| PubChem CID | 19692931 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 6-hydroxy-1,3-dimethyl-3H-indol-2-one |
| SMILES | CC1C(=O)N(C)c2cc(O)ccc21 |
| InChI | InChI=1S/C10H11NO2/c1-6-8-4-3-7(12)5-9(8)11(2)10(6)13/h3-6,12H,1-2H3 |
| InChIKey | YNEVJVGTIHNFEP-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-hydroxy-1,3-dimethyl-3H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-1,3-dimethyl-3H-indol-2-one?
The IUPAC name of 6-hydroxy-1,3-dimethyl-3H-indol-2-one (CID 19692931) is 6-hydroxy-1,3-dimethyl-3H-indol-2-one.
What is the SMILES notation for 6-hydroxy-1,3-dimethyl-3H-indol-2-one?
The canonical SMILES for 6-hydroxy-1,3-dimethyl-3H-indol-2-one is CC1C(=O)N(C)c2cc(O)ccc21.
What is the InChIKey of 6-hydroxy-1,3-dimethyl-3H-indol-2-one?
The InChIKey is YNEVJVGTIHNFEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2/c1-6-8-4-3-7(12)5-9(8)11(2)10(6)13/h3-6,12H,1-2H3.
What are the key properties of 6-hydroxy-1,3-dimethyl-3H-indol-2-one?
6-hydroxy-1,3-dimethyl-3H-indol-2-one has a molecular weight of 177.20 g/mol, XLogP of 1.47, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-1,3-dimethyl-3H-indol-2-one is sourced from PubChem (CID 19692931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).