About triethyl-(N,N,N'-triethylcarbamimidoyl)azanium hexafluorophosphate
triethyl-(N,N,N'-triethylcarbamimidoyl)azanium hexafluorophosphate (PubChem CID 19693200) has the molecular formula C13H30F6N3P
and a molecular weight of 373.37 g/mol. Its IUPAC name is triethyl-(N,N,N'-triethylcarbamimidoyl)azanium hexafluorophosphate.
Molecular Properties
| Compound Name | triethyl-(N,N,N'-triethylcarbamimidoyl)azanium hexafluorophosphate |
| PubChem CID | 19693200 |
| Molecular Formula | C13H30F6N3P |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | triethyl-(N,N,N'-triethylcarbamimidoyl)azanium hexafluorophosphate |
| SMILES | CC/N=C(\N(CC)CC)[N+](CC)(CC)CC.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C13H30N3.F6P/c1-7-14-13(15(8-2)9-3)16(10-4,11-5)12-6;1-7(2,3,4,5)6/h7-12H2,1-6H3;/q+1;-1/b14-13+; |
| InChIKey | MMQYKLJWFNVUNE-IERUDJENSA-N |
| XLogP | 5.96 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze triethyl-(N,N,N'-triethylcarbamimidoyl)azanium hexafluorophosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-(N,N,N'-triethylcarbamimidoyl)azanium hexafluorophosphate?
The IUPAC name of triethyl-(N,N,N'-triethylcarbamimidoyl)azanium hexafluorophosphate (CID 19693200) is triethyl-(N,N,N'-triethylcarbamimidoyl)azanium hexafluorophosphate.
What is the SMILES notation for triethyl-(N,N,N'-triethylcarbamimidoyl)azanium hexafluorophosphate?
The canonical SMILES for triethyl-(N,N,N'-triethylcarbamimidoyl)azanium hexafluorophosphate is CC/N=C(\N(CC)CC)[N+](CC)(CC)CC.F[P-](F)(F)(F)(F)F.
What is the InChIKey of triethyl-(N,N,N'-triethylcarbamimidoyl)azanium hexafluorophosphate?
The InChIKey is MMQYKLJWFNVUNE-IERUDJENSA-N. The full InChI is InChI=1S/C13H30N3.F6P/c1-7-14-13(15(8-2)9-3)16(10-4,11-5)12-6;1-7(2,3,4,5)6/h7-12H2,1-6H3;/q+1;-1/b14-13+;.
What are the key properties of triethyl-(N,N,N'-triethylcarbamimidoyl)azanium hexafluorophosphate?
triethyl-(N,N,N'-triethylcarbamimidoyl)azanium hexafluorophosphate has a molecular weight of 373.37 g/mol, XLogP of 5.96, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-(N,N,N'-triethylcarbamimidoyl)azanium hexafluorophosphate is sourced from PubChem (CID 19693200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).