C19H24N4S2 — CID 19693287
1-[4-[[4-[carbamothioyl(ethyl)amino]phenyl]methyl]phenyl]-1-ethylthiourea (PubChem CID 19693287) has the molecular formula C19H24N4S2 and a molecular weight of 372.56 g/mol. Its IUPAC name is 1-[4-[[4-[carbamothioyl(ethyl)amino]phenyl]methyl]phenyl]-1-ethylthiourea.
| Compound Name | 1-[4-[[4-[carbamothioyl(ethyl)amino]phenyl]methyl]phenyl]-1-ethylthiourea |
|---|---|
| PubChem CID | 19693287 |
| Molecular Formula | C19H24N4S2 |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 1-[4-[[4-[carbamothioyl(ethyl)amino]phenyl]methyl]phenyl]-1-ethylthiourea |
| SMILES | CCN(C(N)=S)c1ccc(Cc2ccc(N(CC)C(N)=S)cc2)cc1 |
| InChI | InChI=1S/C19H24N4S2/c1-3-22(18(20)24)16-9-5-14(6-10-16)13-15-7-11-17(12-8-15)23(4-2)19(21)25/h5-12H,3-4,13H2,1-2H3,(H2,20,24)(H2,21,25) |
| InChIKey | RPYPMACKHSVTBU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|