About 2-(2-hydroxyethoxy)ethanol;3-(pentoxymethyl)heptane
2-(2-hydroxyethoxy)ethanol;3-(pentoxymethyl)heptane (PubChem CID 19693410) has the molecular formula C17H38O4
and a molecular weight of 306.49 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethanol;3-(pentoxymethyl)heptane.
Molecular Properties
| Compound Name | 2-(2-hydroxyethoxy)ethanol;3-(pentoxymethyl)heptane |
| PubChem CID | 19693410 |
| Molecular Formula | C17H38O4 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.28 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethanol;3-(pentoxymethyl)heptane |
| SMILES | CCCCCOCC(CC)CCCC.OCCOCCO |
| InChI | InChI=1S/C13H28O.C4H10O3/c1-4-7-9-11-14-12-13(6-3)10-8-5-2;5-1-3-7-4-2-6/h13H,4-12H2,1-3H3;5-6H,1-4H2 |
| InChIKey | OTAWVUAHYOEQRW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-hydroxyethoxy)ethanol;3-(pentoxymethyl)heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxyethoxy)ethanol;3-(pentoxymethyl)heptane?
The IUPAC name of 2-(2-hydroxyethoxy)ethanol;3-(pentoxymethyl)heptane (CID 19693410) is 2-(2-hydroxyethoxy)ethanol;3-(pentoxymethyl)heptane.
What is the SMILES notation for 2-(2-hydroxyethoxy)ethanol;3-(pentoxymethyl)heptane?
The canonical SMILES for 2-(2-hydroxyethoxy)ethanol;3-(pentoxymethyl)heptane is CCCCCOCC(CC)CCCC.OCCOCCO.
What is the InChIKey of 2-(2-hydroxyethoxy)ethanol;3-(pentoxymethyl)heptane?
The InChIKey is OTAWVUAHYOEQRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28O.C4H10O3/c1-4-7-9-11-14-12-13(6-3)10-8-5-2;5-1-3-7-4-2-6/h13H,4-12H2,1-3H3;5-6H,1-4H2.
What are the key properties of 2-(2-hydroxyethoxy)ethanol;3-(pentoxymethyl)heptane?
2-(2-hydroxyethoxy)ethanol;3-(pentoxymethyl)heptane has a molecular weight of 306.49 g/mol, XLogP of 3.40, 14 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxyethoxy)ethanol;3-(pentoxymethyl)heptane is sourced from PubChem (CID 19693410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).