C24H30O2 — CID 19693752
1,1-bis(methoxymethyl)-7-(2,3,4,5,6-pentamethylphenyl)indene (PubChem CID 19693752) has the molecular formula C24H30O2 and a molecular weight of 350.50 g/mol. Its IUPAC name is 1,1-bis(methoxymethyl)-7-(2,3,4,5,6-pentamethylphenyl)indene.
| Compound Name | 1,1-bis(methoxymethyl)-7-(2,3,4,5,6-pentamethylphenyl)indene |
|---|---|
| PubChem CID | 19693752 |
| Molecular Formula | C24H30O2 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | 1,1-bis(methoxymethyl)-7-(2,3,4,5,6-pentamethylphenyl)indene |
| SMILES | COCC1(COC)C=Cc2cccc(-c3c(C)c(C)c(C)c(C)c3C)c21 |
| InChI | InChI=1S/C24H30O2/c1-15-16(2)18(4)22(19(5)17(15)3)21-10-8-9-20-11-12-24(13-25-6,14-26-7)23(20)21/h8-12H,13-14H2,1-7H3 |
| InChIKey | AQPIOPFXBXDCML-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |