About pyrrolo[2,1-a]isoquinoline-3-carbaldehyde
pyrrolo[2,1-a]isoquinoline-3-carbaldehyde (PubChem CID 19694938) has the molecular formula C13H9NO
and a molecular weight of 195.22 g/mol. Its IUPAC name is pyrrolo[2,1-a]isoquinoline-3-carbaldehyde.
Molecular Properties
| Compound Name | pyrrolo[2,1-a]isoquinoline-3-carbaldehyde |
| PubChem CID | 19694938 |
| Molecular Formula | C13H9NO |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | pyrrolo[2,1-a]isoquinoline-3-carbaldehyde |
| SMILES | O=Cc1ccc2c3ccccc3ccn12 |
| InChI | InChI=1S/C13H9NO/c15-9-11-5-6-13-12-4-2-1-3-10(12)7-8-14(11)13/h1-9H |
| InChIKey | RQYPRPAIQLNXBI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 21.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze pyrrolo[2,1-a]isoquinoline-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolo[2,1-a]isoquinoline-3-carbaldehyde?
The IUPAC name of pyrrolo[2,1-a]isoquinoline-3-carbaldehyde (CID 19694938) is pyrrolo[2,1-a]isoquinoline-3-carbaldehyde.
What is the SMILES notation for pyrrolo[2,1-a]isoquinoline-3-carbaldehyde?
The canonical SMILES for pyrrolo[2,1-a]isoquinoline-3-carbaldehyde is O=Cc1ccc2c3ccccc3ccn12.
What is the InChIKey of pyrrolo[2,1-a]isoquinoline-3-carbaldehyde?
The InChIKey is RQYPRPAIQLNXBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO/c15-9-11-5-6-13-12-4-2-1-3-10(12)7-8-14(11)13/h1-9H.
What are the key properties of pyrrolo[2,1-a]isoquinoline-3-carbaldehyde?
pyrrolo[2,1-a]isoquinoline-3-carbaldehyde has a molecular weight of 195.22 g/mol, XLogP of 2.90, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolo[2,1-a]isoquinoline-3-carbaldehyde is sourced from PubChem (CID 19694938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).