C24H23F3O5S — CID 19695065
ethyl 4-[(E)-2-[5,5-dimethyl-8-(trifluoromethylsulfonyloxy)-6H-naphthalen-2-yl]ethenyl]benzoate (PubChem CID 19695065) has the molecular formula C24H23F3O5S and a molecular weight of 480.50 g/mol. Its IUPAC name is ethyl 4-[(E)-2-[5,5-dimethyl-8-(trifluoromethylsulfonyloxy)-6H-naphthalen-2-yl]ethenyl]benzoate.
| Compound Name | ethyl 4-[(E)-2-[5,5-dimethyl-8-(trifluoromethylsulfonyloxy)-6H-naphthalen-2-yl]ethenyl]benzoate |
|---|---|
| PubChem CID | 19695065 |
| Molecular Formula | C24H23F3O5S |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | ethyl 4-[(E)-2-[5,5-dimethyl-8-(trifluoromethylsulfonyloxy)-6H-naphthalen-2-yl]ethenyl]benzoate |
| SMILES | CCOC(=O)c1ccc(/C=C/c2ccc3c(c2)C(OS(=O)(=O)C(F)(F)F)=CCC3(C)C)cc1 |
| InChI | InChI=1S/C24H23F3O5S/c1-4-31-22(28)18-10-7-16(8-11-18)5-6-17-9-12-20-19(15-17)21(13-14-23(20,2)3)32-33(29,30)24(25,26)27/h5-13,15H,4,14H2,1-3H3/b6-5+ |
| InChIKey | DFSJKZBCINRDJH-AATRIKPKSA-N |
| XLogP | 5.92 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|