C16H20F4 — CID 19695359
1,5,6-trifluoro-6-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]cyclohexa-1,4-diene (PubChem CID 19695359) has the molecular formula C16H20F4 and a molecular weight of 288.33 g/mol. Its IUPAC name is 1,5,6-trifluoro-6-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]cyclohexa-1,4-diene.
| Compound Name | 1,5,6-trifluoro-6-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]cyclohexa-1,4-diene |
|---|---|
| PubChem CID | 19695359 |
| Molecular Formula | C16H20F4 |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 1,5,6-trifluoro-6-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]cyclohexa-1,4-diene |
| SMILES | FCC/C=C/C1CCC(C2(F)C(F)=CCC=C2F)CC1 |
| InChI | InChI=1S/C16H20F4/c17-11-2-1-4-12-7-9-13(10-8-12)16(20)14(18)5-3-6-15(16)19/h1,4-6,12-13H,2-3,7-11H2/b4-1+ |
| InChIKey | RTBHULPCNJACPM-DAFODLJHSA-N |
| XLogP | 5.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|